C20H34O2 — CID 15480767
1-[(1R,2S,7aS)-2-(hydroxymethyl)-1,7,7,7a-tetramethyl-2,3,5,6-tetrahydroinden-1-yl]-4-methylpent-3-en-2-ol (PubChem CID 15480767) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-[(1R,2S,7aS)-2-(hydroxymethyl)-1,7,7,7a-tetramethyl-2,3,5,6-tetrahydroinden-1-yl]-4-methylpent-3-en-2-ol.
| Compound Name | 1-[(1R,2S,7aS)-2-(hydroxymethyl)-1,7,7,7a-tetramethyl-2,3,5,6-tetrahydroinden-1-yl]-4-methylpent-3-en-2-ol |
|---|---|
| PubChem CID | 15480767 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1-[(1R,2S,7aS)-2-(hydroxymethyl)-1,7,7,7a-tetramethyl-2,3,5,6-tetrahydroinden-1-yl]-4-methylpent-3-en-2-ol |
| SMILES | CC(C)=CC(O)C[C@]1(C)[C@@H](CO)CC2=CCCC(C)(C)[C@@]21C |
| InChI | InChI=1S/C20H34O2/c1-14(2)10-17(22)12-19(5)16(13-21)11-15-8-7-9-18(3,4)20(15,19)6/h8,10,16-17,21-22H,7,9,11-13H2,1-6H3/t16-,17?,19-,20-/m1/s1 |
| InChIKey | QJFRTUQMHGTNLS-KGYQZRGHSA-N |
| XLogP | 4.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|