About 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine
4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine (PubChem CID 154811322) has the molecular formula C23H22N4S
and a molecular weight of 386.52 g/mol. Its IUPAC name is 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine |
| PubChem CID | 154811322 |
| Molecular Formula | C23H22N4S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine |
| SMILES | CC1CCN(c2nc(-c3ccccn3)nc3sc(-c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C23H22N4S/c1-16-10-13-27(14-11-16)22-18-15-20(17-7-3-2-4-8-17)28-23(18)26-21(25-22)19-9-5-6-12-24-19/h2-9,12,15-16H,10-11,13-14H2,1H3 |
| InChIKey | HLBBSZIOIHZITO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine?
The IUPAC name of 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine (CID 154811322) is 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine?
The canonical SMILES for 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine is CC1CCN(c2nc(-c3ccccn3)nc3sc(-c4ccccc4)cc23)CC1.
What is the InChIKey of 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine?
The InChIKey is HLBBSZIOIHZITO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4S/c1-16-10-13-27(14-11-16)22-18-15-20(17-7-3-2-4-8-17)28-23(18)26-21(25-22)19-9-5-6-12-24-19/h2-9,12,15-16H,10-11,13-14H2,1H3.
What are the key properties of 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine?
4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine has a molecular weight of 386.52 g/mol, XLogP of 5.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylpiperidin-1-yl)-6-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 154811322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).