C20H26N2O4 — CID 154811354
[(3aS,7aR)-2-(6,7-dimethoxy-4-methylquinolin-2-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154811354) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is [(3aS,7aR)-2-(6,7-dimethoxy-4-methylquinolin-2-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,7aR)-2-(6,7-dimethoxy-4-methylquinolin-2-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154811354 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [(3aS,7aR)-2-(6,7-dimethoxy-4-methylquinolin-2-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | COc1cc2nc(N3C[C@@H]4CCOC[C@]4(CO)C3)cc(C)c2cc1OC |
| InChI | InChI=1S/C20H26N2O4/c1-13-6-19(21-16-8-18(25-3)17(24-2)7-15(13)16)22-9-14-4-5-26-12-20(14,10-22)11-23/h6-8,14,23H,4-5,9-12H2,1-3H3/t14-,20+/m0/s1 |
| InChIKey | OYMYWIPZXYPXQP-VBKZILBWSA-N |
| XLogP | 2.40 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |