C21H26N4O4 — CID 154918694
2-[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-6,7-dimethoxy-4-methylquinoline;formic acid (PubChem CID 154918694) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-6,7-dimethoxy-4-methylquinoline;formic acid.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-6,7-dimethoxy-4-methylquinoline;formic acid |
|---|---|
| PubChem CID | 154918694 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-6,7-dimethoxy-4-methylquinoline;formic acid |
| SMILES | COc1cc2nc(N3CC(n4nc(C)cc4C)C3)cc(C)c2cc1OC.O=CO |
| InChI | InChI=1S/C20H24N4O2.CH2O2/c1-12-6-20(21-17-9-19(26-5)18(25-4)8-16(12)17)23-10-15(11-23)24-14(3)7-13(2)22-24;2-1-3/h6-9,15H,10-11H2,1-5H3;1H,(H,2,3) |
| InChIKey | ADLPVWMXWYXIOE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|