C18H22N2O3S — CID 154921701
formic acid;(1S,5R,6R)-3-(4-methyl-6-methylsulfanylquinolin-2-yl)-3-azabicyclo[3.2.0]heptan-6-ol (PubChem CID 154921701) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is formic acid;(1S,5R,6R)-3-(4-methyl-6-methylsulfanylquinolin-2-yl)-3-azabicyclo[3.2.0]heptan-6-ol.
| Compound Name | formic acid;(1S,5R,6R)-3-(4-methyl-6-methylsulfanylquinolin-2-yl)-3-azabicyclo[3.2.0]heptan-6-ol |
|---|---|
| PubChem CID | 154921701 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | formic acid;(1S,5R,6R)-3-(4-methyl-6-methylsulfanylquinolin-2-yl)-3-azabicyclo[3.2.0]heptan-6-ol |
| SMILES | CSc1ccc2nc(N3C[C@H]4C[C@@H](O)[C@H]4C3)cc(C)c2c1.O=CO |
| InChI | InChI=1S/C17H20N2OS.CH2O2/c1-10-5-17(19-8-11-6-16(20)14(11)9-19)18-15-4-3-12(21-2)7-13(10)15;2-1-3/h3-5,7,11,14,16,20H,6,8-9H2,1-2H3;1H,(H,2,3)/t11-,14+,16-;/m1./s1 |
| InChIKey | UPCGQIWCERUEQE-YMOADCPFSA-N |
| XLogP | 2.78 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|