C23H27N5OS — CID 175645833
(3aR,5R,6R,7aS)-2-(4-methyl-7-methylsulfanylquinolin-2-yl)-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 175645833) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-(4-methyl-7-methylsulfanylquinolin-2-yl)-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-(4-methyl-7-methylsulfanylquinolin-2-yl)-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 175645833 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-(4-methyl-7-methylsulfanylquinolin-2-yl)-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CSc1ccc2c(C)cc(N3C[C@H]4C[C@@H](Nc5cnccn5)[C@H](O)C[C@H]4C3)nc2c1 |
| InChI | InChI=1S/C23H27N5OS/c1-14-7-23(27-19-10-17(30-2)3-4-18(14)19)28-12-15-8-20(21(29)9-16(15)13-28)26-22-11-24-5-6-25-22/h3-7,10-11,15-16,20-21,29H,8-9,12-13H2,1-2H3,(H,25,26)/t15-,16+,20-,21-/m1/s1 |
| InChIKey | DTFBORGLSUSMGA-VAKZPMALSA-N |
| XLogP | 3.74 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |