C24H27N5O2 — CID 172671559
[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,8-dimethylquinolin-3-yl)methanone (PubChem CID 172671559) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,8-dimethylquinolin-3-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,8-dimethylquinolin-3-yl)methanone |
|---|---|
| PubChem CID | 172671559 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2,8-dimethylquinolin-3-yl)methanone |
| SMILES | Cc1nc2c(C)cccc2cc1C(=O)N1C[C@H]2C[C@@H](Nc3cnccn3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C24H27N5O2/c1-14-4-3-5-16-8-19(15(2)27-23(14)16)24(31)29-12-17-9-20(21(30)10-18(17)13-29)28-22-11-25-6-7-26-22/h3-8,11,17-18,20-21,30H,9-10,12-13H2,1-2H3,(H,26,28)/t17-,18+,20-,21-/m1/s1 |
| InChIKey | TUXONOSIJOQZOI-KOUHRCEDSA-N |
| XLogP | 2.97 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |