C21H26N4O3 — CID 172667878
methyl 4-[[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]benzoate (PubChem CID 172667878) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 4-[[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 172667878 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | methyl 4-[[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C[C@H]3C[C@@H](Nc4cnccn4)[C@H](O)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C21H26N4O3/c1-28-21(27)15-4-2-14(3-5-15)11-25-12-16-8-18(19(26)9-17(16)13-25)24-20-10-22-6-7-23-20/h2-7,10,16-19,26H,8-9,11-13H2,1H3,(H,23,24)/t16-,17+,18-,19-/m1/s1 |
| InChIKey | VAKHJELIRSBVRD-FCGDIQPGSA-N |
| XLogP | 1.95 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |