C22H28N4O3 — CID 172668087
[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-propoxyphenyl)methanone (PubChem CID 172668087) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-propoxyphenyl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-propoxyphenyl)methanone |
|---|---|
| PubChem CID | 172668087 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-propoxyphenyl)methanone |
| SMILES | CCCOc1ccc(C(=O)N2C[C@H]3C[C@@H](Nc4cnccn4)[C@H](O)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-2-9-29-18-5-3-15(4-6-18)22(28)26-13-16-10-19(20(27)11-17(16)14-26)25-21-12-23-7-8-24-21/h3-8,12,16-17,19-20,27H,2,9-11,13-14H2,1H3,(H,24,25)/t16-,17+,19-,20-/m1/s1 |
| InChIKey | OPPAIQARUNQNNO-PIKOESSRSA-N |
| XLogP | 2.59 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |