C20H24FN5O2 — CID 172656911
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(4-fluoroanilino)ethanone (PubChem CID 172656911) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(4-fluoroanilino)ethanone.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(4-fluoroanilino)ethanone |
|---|---|
| PubChem CID | 172656911 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-(pyrazin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(4-fluoroanilino)ethanone |
| SMILES | O=C(CNc1ccc(F)cc1)N1C[C@H]2C[C@@H](Nc3cnccn3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C20H24FN5O2/c21-15-1-3-16(4-2-15)24-10-20(28)26-11-13-7-17(18(27)8-14(13)12-26)25-19-9-22-5-6-23-19/h1-6,9,13-14,17-18,24,27H,7-8,10-12H2,(H,23,25)/t13-,14+,17-,18-/m1/s1 |
| InChIKey | AKWWRKXNHYSXQI-LTCOOKNTSA-N |
| XLogP | 1.74 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |