C21H31N5O3 — CID 138382002
[5-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2-butyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 138382002) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is [5-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2-butyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [5-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2-butyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 138382002 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | [5-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2-butyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | CCCCN1CC2CN(c3nc(N)c4cc(OC)c(OC)cc4n3)CC2(CO)C1 |
| InChI | InChI=1S/C21H31N5O3/c1-4-5-6-25-9-14-10-26(12-21(14,11-25)13-27)20-23-16-8-18(29-3)17(28-2)7-15(16)19(22)24-20/h7-8,14,27H,4-6,9-13H2,1-3H3,(H2,22,23,24) |
| InChIKey | LBCCIASQDZSOGV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |