C23H31N5O3 — CID 154813019
(3aS,5S,6S,7aR)-N-benzyl-5-[2-(dimethylamino)-2-oxoethoxy]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 154813019) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-N-benzyl-5-[2-(dimethylamino)-2-oxoethoxy]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | (3aS,5S,6S,7aR)-N-benzyl-5-[2-(dimethylamino)-2-oxoethoxy]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 154813019 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (3aS,5S,6S,7aR)-N-benzyl-5-[2-(dimethylamino)-2-oxoethoxy]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | CN(C)C(=O)CO[C@H]1C[C@@H]2CN(C(=O)NCc3ccccc3)C[C@@H]2C[C@@H]1n1cccn1 |
| InChI | InChI=1S/C23H31N5O3/c1-26(2)22(29)16-31-21-12-19-15-27(23(30)24-13-17-7-4-3-5-8-17)14-18(19)11-20(21)28-10-6-9-25-28/h3-10,18-21H,11-16H2,1-2H3,(H,24,30)/t18-,19+,20-,21-/m0/s1 |
| InChIKey | AVZLGCINCYMYHR-WOZUAGRISA-N |
| XLogP | 2.15 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |