C21H34N4O2 — CID 154813062
2-[[(3aS,5S,6S,7aR)-2-cyclohexyl-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]-N,N-dimethylacetamide (PubChem CID 154813062) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-[[(3aS,5S,6S,7aR)-2-cyclohexyl-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3aS,5S,6S,7aR)-2-cyclohexyl-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 154813062 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 2-[[(3aS,5S,6S,7aR)-2-cyclohexyl-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CO[C@H]1C[C@@H]2CN(C3CCCCC3)C[C@@H]2C[C@@H]1n1cccn1 |
| InChI | InChI=1S/C21H34N4O2/c1-23(2)21(26)15-27-20-12-17-14-24(18-7-4-3-5-8-18)13-16(17)11-19(20)25-10-6-9-22-25/h6,9-10,16-20H,3-5,7-8,11-15H2,1-2H3/t16-,17+,19-,20-/m0/s1 |
| InChIKey | VSAXBQPRHWJYAJ-HNJRGHQBSA-N |
| XLogP | 2.57 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |