C16H17NO3 — CID 154815492
(4S)-4-(2-methoxyphenyl)-3,4,4a,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 154815492) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (4S)-4-(2-methoxyphenyl)-3,4,4a,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | (4S)-4-(2-methoxyphenyl)-3,4,4a,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 154815492 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (4S)-4-(2-methoxyphenyl)-3,4,4a,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1ccccc1[C@H]1CC(=O)N=C2CCCC(=O)C21 |
| InChI | InChI=1S/C16H17NO3/c1-20-14-8-3-2-5-10(14)11-9-15(19)17-12-6-4-7-13(18)16(11)12/h2-3,5,8,11,16H,4,6-7,9H2,1H3/t11-,16?/m1/s1 |
| InChIKey | IXENIRJPGZPUPK-ZVDHGWRTSA-N |
| XLogP | 2.52 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |