C23H32N6O5 — CID 154817932
(13S)-13-[(1R)-1-hydroxyethyl]-19-methyl-8-[(1-methylimidazol-2-yl)methyl]-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione (PubChem CID 154817932) has the molecular formula C23H32N6O5 and a molecular weight of 472.55 g/mol. Its IUPAC name is (13S)-13-[(1R)-1-hydroxyethyl]-19-methyl-8-[(1-methylimidazol-2-yl)methyl]-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione.
| Compound Name | (13S)-13-[(1R)-1-hydroxyethyl]-19-methyl-8-[(1-methylimidazol-2-yl)methyl]-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione |
|---|---|
| PubChem CID | 154817932 |
| Molecular Formula | C23H32N6O5 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (13S)-13-[(1R)-1-hydroxyethyl]-19-methyl-8-[(1-methylimidazol-2-yl)methyl]-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione |
| SMILES | Cc1ccc2cc1OCCNC(=O)CN(Cc1nccn1C)CCNC(=O)[C@H]([C@@H](C)O)NC2=O |
| InChI | InChI=1S/C23H32N6O5/c1-15-4-5-17-12-18(15)34-11-8-25-20(31)14-29(13-19-24-6-9-28(19)3)10-7-26-23(33)21(16(2)30)27-22(17)32/h4-6,9,12,16,21,30H,7-8,10-11,13-14H2,1-3H3,(H,25,31)(H,26,33)(H,27,32)/t16-,21+/m1/s1 |
| InChIKey | LJDROBYFAFAPNB-IERDGZPVSA-N |
| XLogP | -0.67 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |