C32H36N4O6 — CID 154816849
(13S)-13-[(1R)-1-hydroxyethyl]-19-methyl-8-[2-(4-phenylphenyl)acetyl]-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione (PubChem CID 154816849) has the molecular formula C32H36N4O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is (13S)-13-[(1R)-1-hydroxyethyl]-19-methyl-8-[2-(4-phenylphenyl)acetyl]-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione.
| Compound Name | (13S)-13-[(1R)-1-hydroxyethyl]-19-methyl-8-[2-(4-phenylphenyl)acetyl]-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione |
|---|---|
| PubChem CID | 154816849 |
| Molecular Formula | C32H36N4O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (13S)-13-[(1R)-1-hydroxyethyl]-19-methyl-8-[2-(4-phenylphenyl)acetyl]-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione |
| SMILES | Cc1ccc2cc1OCCNC(=O)CN(C(=O)Cc1ccc(-c3ccccc3)cc1)CCNC(=O)[C@H]([C@@H](C)O)NC2=O |
| InChI | InChI=1S/C32H36N4O6/c1-21-8-11-26-19-27(21)42-17-15-33-28(38)20-36(16-14-34-32(41)30(22(2)37)35-31(26)40)29(39)18-23-9-12-25(13-10-23)24-6-4-3-5-7-24/h3-13,19,22,30,37H,14-18,20H2,1-2H3,(H,33,38)(H,34,41)(H,35,40)/t22-,30+/m1/s1 |
| InChIKey | FFNSXTFKRNMZSM-RCRUUEGKSA-N |
| XLogP | 1.84 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |