C26H30F2N4O6 — CID 154822589
(13S)-8-[2-(3,4-difluorophenyl)acetyl]-13-[(1R)-1-hydroxyethyl]-19-methyl-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione (PubChem CID 154822589) has the molecular formula C26H30F2N4O6 and a molecular weight of 532.54 g/mol. Its IUPAC name is (13S)-8-[2-(3,4-difluorophenyl)acetyl]-13-[(1R)-1-hydroxyethyl]-19-methyl-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione.
| Compound Name | (13S)-8-[2-(3,4-difluorophenyl)acetyl]-13-[(1R)-1-hydroxyethyl]-19-methyl-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione |
|---|---|
| PubChem CID | 154822589 |
| Molecular Formula | C26H30F2N4O6 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | (13S)-8-[2-(3,4-difluorophenyl)acetyl]-13-[(1R)-1-hydroxyethyl]-19-methyl-2-oxa-5,8,11,14-tetrazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-6,12,15-trione |
| SMILES | Cc1ccc2cc1OCCNC(=O)CN(C(=O)Cc1ccc(F)c(F)c1)CCNC(=O)[C@H]([C@@H](C)O)NC2=O |
| InChI | InChI=1S/C26H30F2N4O6/c1-15-3-5-18-13-21(15)38-10-8-29-22(34)14-32(23(35)12-17-4-6-19(27)20(28)11-17)9-7-30-26(37)24(16(2)33)31-25(18)36/h3-6,11,13,16,24,33H,7-10,12,14H2,1-2H3,(H,29,34)(H,30,37)(H,31,36)/t16-,24+/m1/s1 |
| InChIKey | PJRDWJNVJFBUOR-GYCJOSAFSA-N |
| XLogP | 0.45 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |