C21H27ClN4O2 — CID 154818181
[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]methanone (PubChem CID 154818181) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is [(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]methanone.
| Compound Name | [(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 154818181 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-6-yl]-[1-(6-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2nc3ccc(Cl)cc3o2)CC1)N1CC[C@@H]2NCCC[C@@H]2C1 |
| InChI | InChI=1S/C21H27ClN4O2/c22-16-3-4-18-19(12-16)28-21(24-18)25-9-5-14(6-10-25)20(27)26-11-7-17-15(13-26)2-1-8-23-17/h3-4,12,14-15,17,23H,1-2,5-11,13H2/t15-,17+/m1/s1 |
| InChIKey | CMEMMWUUVGHDBC-WBVHZDCISA-N |
| XLogP | 3.30 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |