C24H28N4O4 — CID 154818546
methyl (6R,7S,8aS)-2-[2-[methyl(pyridin-4-ylmethyl)amino]acetyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate (PubChem CID 154818546) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl (6R,7S,8aS)-2-[2-[methyl(pyridin-4-ylmethyl)amino]acetyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate.
| Compound Name | methyl (6R,7S,8aS)-2-[2-[methyl(pyridin-4-ylmethyl)amino]acetyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 154818546 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | methyl (6R,7S,8aS)-2-[2-[methyl(pyridin-4-ylmethyl)amino]acetyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2CN(C(=O)CN(C)Cc3ccncc3)CC(=O)N2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H28N4O4/c1-26(13-17-8-10-25-11-9-17)15-21(29)27-14-19-12-20(24(31)32-2)23(28(19)22(30)16-27)18-6-4-3-5-7-18/h3-11,19-20,23H,12-16H2,1-2H3/t19-,20-,23-/m0/s1 |
| InChIKey | CUHYZXDSARACDB-JTAQYXEDSA-N |
| XLogP | 1.49 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |