C22H30N2O3 — CID 154823959
methyl (6R,7S,8aS)-2-(cyclohexylmethyl)-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate (PubChem CID 154823959) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is methyl (6R,7S,8aS)-2-(cyclohexylmethyl)-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate.
| Compound Name | methyl (6R,7S,8aS)-2-(cyclohexylmethyl)-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 154823959 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | methyl (6R,7S,8aS)-2-(cyclohexylmethyl)-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2CN(CC3CCCCC3)CC(=O)N2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H30N2O3/c1-27-22(26)19-12-18-14-23(13-16-8-4-2-5-9-16)15-20(25)24(18)21(19)17-10-6-3-7-11-17/h3,6-7,10-11,16,18-19,21H,2,4-5,8-9,12-15H2,1H3/t18-,19-,21-/m0/s1 |
| InChIKey | SEQLOIRRHKORJB-ZJOUEHCJSA-N |
| XLogP | 3.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |