C22H22FN3O4 — CID 155510213
methyl (6R,7S,8aS)-2-[(2-fluorophenyl)carbamoyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate (PubChem CID 155510213) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is methyl (6R,7S,8aS)-2-[(2-fluorophenyl)carbamoyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate.
| Compound Name | methyl (6R,7S,8aS)-2-[(2-fluorophenyl)carbamoyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 155510213 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | methyl (6R,7S,8aS)-2-[(2-fluorophenyl)carbamoyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2CN(C(=O)Nc3ccccc3F)CC(=O)N2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H22FN3O4/c1-30-21(28)16-11-15-12-25(22(29)24-18-10-6-5-9-17(18)23)13-19(27)26(15)20(16)14-7-3-2-4-8-14/h2-10,15-16,20H,11-13H2,1H3,(H,24,29)/t15-,16-,20-/m0/s1 |
| InChIKey | UAZZFIUKSMVYJZ-FTRWYGJKSA-N |
| XLogP | 2.80 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |