C20H22N4O4S — CID 154819150
methyl (6R,7S,8aS)-2-[2-(methylamino)-1,3-thiazole-4-carbonyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate (PubChem CID 154819150) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is methyl (6R,7S,8aS)-2-[2-(methylamino)-1,3-thiazole-4-carbonyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate.
| Compound Name | methyl (6R,7S,8aS)-2-[2-(methylamino)-1,3-thiazole-4-carbonyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 154819150 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | methyl (6R,7S,8aS)-2-[2-(methylamino)-1,3-thiazole-4-carbonyl]-4-oxo-6-phenyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxylate |
| SMILES | CNc1nc(C(=O)N2CC(=O)N3[C@@H](C[C@H](C(=O)OC)[C@@H]3c3ccccc3)C2)cs1 |
| InChI | InChI=1S/C20H22N4O4S/c1-21-20-22-15(11-29-20)18(26)23-9-13-8-14(19(27)28-2)17(24(13)16(25)10-23)12-6-4-3-5-7-12/h3-7,11,13-14,17H,8-10H2,1-2H3,(H,21,22)/t13-,14-,17-/m0/s1 |
| InChIKey | RHUDLAMZULTLAL-ZQIUZPCESA-N |
| XLogP | 1.77 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |