C20H28N4O3 — CID 154818693
N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-6-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 154818693) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-6-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-6-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 154818693 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-6-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H]2CO[C@@H](C3CC3)CN2C1)c1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C20H28N4O3/c25-20(15-3-4-19(21-10-15)23-5-7-26-8-6-23)22-16-9-17-13-27-18(14-1-2-14)12-24(17)11-16/h3-4,10,14,16-18H,1-2,5-9,11-13H2,(H,22,25)/t16-,17-,18+/m0/s1 |
| InChIKey | BPHQGKBVXGINAZ-OKZBNKHCSA-N |
| XLogP | 0.90 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |