C18H21N3O3S — CID 154819992
[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-quinolin-2-ylmethanone (PubChem CID 154819992) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-quinolin-2-ylmethanone.
| Compound Name | [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-quinolin-2-ylmethanone |
|---|---|
| PubChem CID | 154819992 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-quinolin-2-ylmethanone |
| SMILES | CN(C)[C@@H]1CS(=O)(=O)[C@H]2CN(C(=O)c3ccc4ccccc4n3)C[C@@H]12 |
| InChI | InChI=1S/C18H21N3O3S/c1-20(2)16-11-25(23,24)17-10-21(9-13(16)17)18(22)15-8-7-12-5-3-4-6-14(12)19-15/h3-8,13,16-17H,9-11H2,1-2H3/t13-,16+,17-/m0/s1 |
| InChIKey | ALDLUSMSVTXETH-XKQJLSEDSA-N |
| XLogP | 1.03 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |