C19H23N5O3S — CID 155505953
[(3R,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2-anilinopyrimidin-5-yl)methanone (PubChem CID 155505953) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is [(3R,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2-anilinopyrimidin-5-yl)methanone.
| Compound Name | [(3R,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2-anilinopyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 155505953 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [(3R,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(2-anilinopyrimidin-5-yl)methanone |
| SMILES | CN(C)[C@H]1CS(=O)(=O)[C@H]2CN(C(=O)c3cnc(Nc4ccccc4)nc3)C[C@@H]12 |
| InChI | InChI=1S/C19H23N5O3S/c1-23(2)16-12-28(26,27)17-11-24(10-15(16)17)18(25)13-8-20-19(21-9-13)22-14-6-4-3-5-7-14/h3-9,15-17H,10-12H2,1-2H3,(H,20,21,22)/t15-,16-,17-/m0/s1 |
| InChIKey | ZDXHRETVBSWNIK-ULQDDVLXSA-N |
| XLogP | 1.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |