C18H20ClN3O3S — CID 155510012
[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(6-chloroquinolin-5-yl)methanone (PubChem CID 155510012) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(6-chloroquinolin-5-yl)methanone.
| Compound Name | [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(6-chloroquinolin-5-yl)methanone |
|---|---|
| PubChem CID | 155510012 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(6-chloroquinolin-5-yl)methanone |
| SMILES | CN(C)[C@@H]1CS(=O)(=O)[C@H]2CN(C(=O)c3c(Cl)ccc4ncccc34)C[C@@H]12 |
| InChI | InChI=1S/C18H20ClN3O3S/c1-21(2)15-10-26(24,25)16-9-22(8-12(15)16)18(23)17-11-4-3-7-20-14(11)6-5-13(17)19/h3-7,12,15-16H,8-10H2,1-2H3/t12-,15+,16-/m0/s1 |
| InChIKey | YPYUNCAIICWLOH-MAZHCROVSA-N |
| XLogP | 1.69 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |