C14H18ClFN2O4S2 — CID 154821227
(3S,3aS,6aR)-5-(3-chloro-4-fluorophenyl)sulfonyl-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine (PubChem CID 154821227) has the molecular formula C14H18ClFN2O4S2 and a molecular weight of 396.89 g/mol. Its IUPAC name is (3S,3aS,6aR)-5-(3-chloro-4-fluorophenyl)sulfonyl-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine.
| Compound Name | (3S,3aS,6aR)-5-(3-chloro-4-fluorophenyl)sulfonyl-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
|---|---|
| PubChem CID | 154821227 |
| Molecular Formula | C14H18ClFN2O4S2 |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (3S,3aS,6aR)-5-(3-chloro-4-fluorophenyl)sulfonyl-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
| SMILES | CN(C)[C@@H]1CS(=O)(=O)[C@H]2CN(S(=O)(=O)c3ccc(F)c(Cl)c3)C[C@@H]12 |
| InChI | InChI=1S/C14H18ClFN2O4S2/c1-17(2)13-8-23(19,20)14-7-18(6-10(13)14)24(21,22)9-3-4-12(16)11(15)5-9/h3-5,10,13-14H,6-8H2,1-2H3/t10-,13+,14-/m0/s1 |
| InChIKey | CDQBMKMSQLZJFE-GDLCADMTSA-N |
| XLogP | 0.83 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |