C17H19F2NO3 — CID 154821255
2-(2,4-difluorophenyl)-1-[(1S,5S,6R,7R)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]ethanone (PubChem CID 154821255) has the molecular formula C17H19F2NO3 and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[(1S,5S,6R,7R)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]ethanone.
| Compound Name | 2-(2,4-difluorophenyl)-1-[(1S,5S,6R,7R)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]ethanone |
|---|---|
| PubChem CID | 154821255 |
| Molecular Formula | C17H19F2NO3 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[(1S,5S,6R,7R)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]ethanone |
| SMILES | O=C(Cc1ccc(F)cc1F)N1C[C@@H]2[C@H](CO)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C17H19F2NO3/c18-11-2-1-10(14(19)6-11)5-16(22)20-7-13-12(8-21)15-3-4-17(13,9-20)23-15/h1-2,6,12-13,15,21H,3-5,7-9H2/t12-,13+,15+,17+/m0/s1 |
| InChIKey | ZXWHPDCNEAPSSI-TZDHZFECSA-N |
| XLogP | 1.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |