C15H22N4O3 — CID 164697172
1-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-4-(1,2,4-triazol-1-yl)butan-1-one (PubChem CID 164697172) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-4-(1,2,4-triazol-1-yl)butan-1-one.
| Compound Name | 1-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-4-(1,2,4-triazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 164697172 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-4-(1,2,4-triazol-1-yl)butan-1-one |
| SMILES | O=C(CCCn1cncn1)N1C[C@H]2[C@@H](CO)[C@@H]3CC[C@@]2(C1)O3 |
| InChI | InChI=1S/C15H22N4O3/c20-7-11-12-6-18(8-15(12)4-3-13(11)22-15)14(21)2-1-5-19-10-16-9-17-19/h9-13,20H,1-8H2/t11-,12+,13+,15+/m1/s1 |
| InChIKey | JUYSZCZGKVRSLZ-OSFYFWSMSA-N |
| XLogP | 0.06 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |