C17H23FN2O3S — CID 154821645
N-[(3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(4-fluorophenyl)methanesulfonamide (PubChem CID 154821645) has the molecular formula C17H23FN2O3S and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[(3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(4-fluorophenyl)methanesulfonamide.
| Compound Name | N-[(3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(4-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 154821645 |
| Molecular Formula | C17H23FN2O3S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[(3R,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(4-fluorophenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)N[C@@H]1C[C@H]2CO[C@H](C3CC3)CN2C1 |
| InChI | InChI=1S/C17H23FN2O3S/c18-14-5-1-12(2-6-14)11-24(21,22)19-15-7-16-10-23-17(13-3-4-13)9-20(16)8-15/h1-2,5-6,13,15-17,19H,3-4,7-11H2/t15-,16+,17+/m1/s1 |
| InChIKey | ZYMFLLOUNDFENJ-IKGGRYGDSA-N |
| XLogP | 1.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |