C16H21F2N3O3 — CID 154821902
1-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(2,5-difluorophenyl)urea (PubChem CID 154821902) has the molecular formula C16H21F2N3O3 and a molecular weight of 341.36 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(2,5-difluorophenyl)urea.
| Compound Name | 1-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(2,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 154821902 |
| Molecular Formula | C16H21F2N3O3 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(2,5-difluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)ccc1F)N[C@H]1C[C@H]2CO[C@@H](CCO)CN2C1 |
| InChI | InChI=1S/C16H21F2N3O3/c17-10-1-2-14(18)15(5-10)20-16(23)19-11-6-12-9-24-13(3-4-22)8-21(12)7-11/h1-2,5,11-13,22H,3-4,6-9H2,(H2,19,20,23)/t11-,12-,13-/m0/s1 |
| InChIKey | PDMHTUITNNCFKT-AVGNSLFASA-N |
| XLogP | 1.31 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |