C12H17N5O2 — CID 154830347
4-[1-(6-methoxypyrimidin-4-yl)azetidin-3-yl]piperazin-2-one (PubChem CID 154830347) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[1-(6-methoxypyrimidin-4-yl)azetidin-3-yl]piperazin-2-one.
| Compound Name | 4-[1-(6-methoxypyrimidin-4-yl)azetidin-3-yl]piperazin-2-one |
|---|---|
| PubChem CID | 154830347 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 4-[1-(6-methoxypyrimidin-4-yl)azetidin-3-yl]piperazin-2-one |
| SMILES | COc1cc(N2CC(N3CCNC(=O)C3)C2)ncn1 |
| InChI | InChI=1S/C12H17N5O2/c1-19-12-4-10(14-8-15-12)17-5-9(6-17)16-3-2-13-11(18)7-16/h4,8-9H,2-3,5-7H2,1H3,(H,13,18) |
| InChIKey | FJYBYIIODZKJGL-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |