C26H17N3O4 — CID 154835094
N-[3-(1,3-dihydroxyisoindol-2-yl)benzoyl]iminonaphthalene-2-carboxamide (PubChem CID 154835094) has the molecular formula C26H17N3O4 and a molecular weight of 435.44 g/mol. Its IUPAC name is N-[3-(1,3-dihydroxyisoindol-2-yl)benzoyl]iminonaphthalene-2-carboxamide.
| Compound Name | N-[3-(1,3-dihydroxyisoindol-2-yl)benzoyl]iminonaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 154835094 |
| Molecular Formula | C26H17N3O4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[3-(1,3-dihydroxyisoindol-2-yl)benzoyl]iminonaphthalene-2-carboxamide |
| SMILES | O=C(/N=N/C(=O)c1ccc2ccccc2c1)c1cccc(-n2c(O)c3ccccc3c2O)c1 |
| InChI | InChI=1S/C26H17N3O4/c30-23(27-28-24(31)19-13-12-16-6-1-2-7-17(16)14-19)18-8-5-9-20(15-18)29-25(32)21-10-3-4-11-22(21)26(29)33/h1-15,32-33H/b28-27+ |
| InChIKey | LCBUHJVSYZUPJP-BYYHNAKLSA-N |
| XLogP | 5.63 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|