C13H14N2O5S2 — CID 154837640
3-[(5-methoxy-3-pyridinyl)sulfonylamino]-3-thiophen-3-ylpropanoic acid (PubChem CID 154837640) has the molecular formula C13H14N2O5S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-[(5-methoxy-3-pyridinyl)sulfonylamino]-3-thiophen-3-ylpropanoic acid.
| Compound Name | 3-[(5-methoxy-3-pyridinyl)sulfonylamino]-3-thiophen-3-ylpropanoic acid |
|---|---|
| PubChem CID | 154837640 |
| Molecular Formula | C13H14N2O5S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 3-[(5-methoxy-3-pyridinyl)sulfonylamino]-3-thiophen-3-ylpropanoic acid |
| SMILES | COc1cncc(S(=O)(=O)NC(CC(=O)O)c2ccsc2)c1 |
| InChI | InChI=1S/C13H14N2O5S2/c1-20-10-4-11(7-14-6-10)22(18,19)15-12(5-13(16)17)9-2-3-21-8-9/h2-4,6-8,12,15H,5H2,1H3,(H,16,17) |
| InChIKey | LKAFGGLRFOTJBB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |