C18H24F3N3O3 — CID 154838352
N-cyclohexyl-4-[[2-(trifluoromethyl)furan-3-carbonyl]amino]piperidine-1-carboxamide (PubChem CID 154838352) has the molecular formula C18H24F3N3O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-cyclohexyl-4-[[2-(trifluoromethyl)furan-3-carbonyl]amino]piperidine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[[2-(trifluoromethyl)furan-3-carbonyl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 154838352 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-cyclohexyl-4-[[2-(trifluoromethyl)furan-3-carbonyl]amino]piperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)NC2CCCCC2)CC1)c1ccoc1C(F)(F)F |
| InChI | InChI=1S/C18H24F3N3O3/c19-18(20,21)15-14(8-11-27-15)16(25)22-13-6-9-24(10-7-13)17(26)23-12-4-2-1-3-5-12/h8,11-13H,1-7,9-10H2,(H,22,25)(H,23,26) |
| InChIKey | BOCIXGUISFMCOX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |