C21H23F3N4O2 — CID 154839340
3-(4-isoquinolin-5-yl-2-methylpiperazine-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one (PubChem CID 154839340) has the molecular formula C21H23F3N4O2 and a molecular weight of 420.44 g/mol. Its IUPAC name is 3-(4-isoquinolin-5-yl-2-methylpiperazine-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one.
| Compound Name | 3-(4-isoquinolin-5-yl-2-methylpiperazine-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one |
|---|---|
| PubChem CID | 154839340 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-(4-isoquinolin-5-yl-2-methylpiperazine-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one |
| SMILES | CC1CN(c2cccc3cnccc23)CCN1C(=O)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C21H23F3N4O2/c1-13-12-27(17-4-2-3-14-11-25-8-7-15(14)17)9-10-28(13)20(30)16-5-6-18(21(22,23)24)26-19(16)29/h2-4,7-8,11,13,16,18H,5-6,9-10,12H2,1H3,(H,26,29) |
| InChIKey | SZESIRPOTOQCMG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|