C24H29N5O — CID 166233945
N-[3-[(dimethylamino)methyl]phenyl]-4-isoquinolin-5-yl-2-methylpiperazine-1-carboxamide (PubChem CID 166233945) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[3-[(dimethylamino)methyl]phenyl]-4-isoquinolin-5-yl-2-methylpiperazine-1-carboxamide.
| Compound Name | N-[3-[(dimethylamino)methyl]phenyl]-4-isoquinolin-5-yl-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 166233945 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-[3-[(dimethylamino)methyl]phenyl]-4-isoquinolin-5-yl-2-methylpiperazine-1-carboxamide |
| SMILES | CC1CN(c2cccc3cnccc23)CCN1C(=O)Nc1cccc(CN(C)C)c1 |
| InChI | InChI=1S/C24H29N5O/c1-18-16-28(23-9-5-7-20-15-25-11-10-22(20)23)12-13-29(18)24(30)26-21-8-4-6-19(14-21)17-27(2)3/h4-11,14-15,18H,12-13,16-17H2,1-3H3,(H,26,30) |
| InChIKey | BUQNCKDQQBSLCW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |