C14H21N3O4S — CID 154840056
2-[cyclopropylsulfamoyl(pyridin-3-ylmethyl)amino]-3-methylbutanoic acid (PubChem CID 154840056) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[cyclopropylsulfamoyl(pyridin-3-ylmethyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[cyclopropylsulfamoyl(pyridin-3-ylmethyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 154840056 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[cyclopropylsulfamoyl(pyridin-3-ylmethyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N(Cc1cccnc1)S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C14H21N3O4S/c1-10(2)13(14(18)19)17(9-11-4-3-7-15-8-11)22(20,21)16-12-5-6-12/h3-4,7-8,10,12-13,16H,5-6,9H2,1-2H3,(H,18,19) |
| InChIKey | SLHWSHHFZRJOLZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |