C20H26N2O6S — CID 89373332
(2R)-2-[[(2E,4E)-5-methoxycarbonylhepta-2,4,6-trien-2-yl]sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanoic acid (PubChem CID 89373332) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is (2R)-2-[[(2E,4E)-5-methoxycarbonylhepta-2,4,6-trien-2-yl]sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[(2E,4E)-5-methoxycarbonylhepta-2,4,6-trien-2-yl]sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 89373332 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (2R)-2-[[(2E,4E)-5-methoxycarbonylhepta-2,4,6-trien-2-yl]sulfonyl-(pyridin-3-ylmethyl)amino]-3-methylbutanoic acid |
| SMILES | C=C/C(=C\C=C(/C)S(=O)(=O)N(Cc1cccnc1)[C@@H](C(=O)O)C(C)C)C(=O)OC |
| InChI | InChI=1S/C20H26N2O6S/c1-6-17(20(25)28-5)10-9-15(4)29(26,27)22(18(14(2)3)19(23)24)13-16-8-7-11-21-12-16/h6-12,14,18H,1,13H2,2-5H3,(H,23,24)/b15-9+,17-10+/t18-/m1/s1 |
| InChIKey | HELQTDHKGVOBST-BXXNBLRLSA-N |
| XLogP | 2.51 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|