C22H30N4O5S — CID 18727198
(2R)-N-hydroxy-3-methyl-2-[(4-phenoxypiperidin-1-yl)sulfonyl-(pyridin-3-ylmethyl)amino]butanamide (PubChem CID 18727198) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is (2R)-N-hydroxy-3-methyl-2-[(4-phenoxypiperidin-1-yl)sulfonyl-(pyridin-3-ylmethyl)amino]butanamide.
| Compound Name | (2R)-N-hydroxy-3-methyl-2-[(4-phenoxypiperidin-1-yl)sulfonyl-(pyridin-3-ylmethyl)amino]butanamide |
|---|---|
| PubChem CID | 18727198 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (2R)-N-hydroxy-3-methyl-2-[(4-phenoxypiperidin-1-yl)sulfonyl-(pyridin-3-ylmethyl)amino]butanamide |
| SMILES | CC(C)[C@H](C(=O)NO)N(Cc1cccnc1)S(=O)(=O)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N4O5S/c1-17(2)21(22(27)24-28)26(16-18-7-6-12-23-15-18)32(29,30)25-13-10-20(11-14-25)31-19-8-4-3-5-9-19/h3-9,12,15,17,20-21,28H,10-11,13-14,16H2,1-2H3,(H,24,27)/t21-/m1/s1 |
| InChIKey | OBLYYKNCLJUBRK-OAQYLSRUSA-N |
| XLogP | 2.20 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|