About N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide
N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide (PubChem CID 154842874) has the molecular formula C17H19NO4S2
and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide |
| PubChem CID | 154842874 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NC2CS(=O)(=O)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C17H19NO4S2/c1-2-13-7-9-15(10-8-13)24(21,22)18-17-12-23(19,20)11-14-5-3-4-6-16(14)17/h3-10,17-18H,2,11-12H2,1H3 |
| InChIKey | UHSFHAAATLAIEY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide?
The IUPAC name of N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide (CID 154842874) is N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide.
What is the SMILES notation for N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide?
The canonical SMILES for N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide is CCc1ccc(S(=O)(=O)NC2CS(=O)(=O)Cc3ccccc32)cc1.
What is the InChIKey of N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide?
The InChIKey is UHSFHAAATLAIEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4S2/c1-2-13-7-9-15(10-8-13)24(21,22)18-17-12-23(19,20)11-14-5-3-4-6-16(14)17/h3-10,17-18H,2,11-12H2,1H3.
What are the key properties of N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide?
N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide has a molecular weight of 365.48 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl)-4-ethylbenzenesulfonamide is sourced from PubChem (CID 154842874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).