C15H22ClNO2 — CID 154843186
methyl 2-(3-methylphenyl)-2-piperidin-4-ylacetate;hydrochloride (PubChem CID 154843186) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is methyl 2-(3-methylphenyl)-2-piperidin-4-ylacetate;hydrochloride.
| Compound Name | methyl 2-(3-methylphenyl)-2-piperidin-4-ylacetate;hydrochloride |
|---|---|
| PubChem CID | 154843186 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | methyl 2-(3-methylphenyl)-2-piperidin-4-ylacetate;hydrochloride |
| SMILES | COC(=O)C(c1cccc(C)c1)C1CCNCC1.Cl |
| InChI | InChI=1S/C15H21NO2.ClH/c1-11-4-3-5-13(10-11)14(15(17)18-2)12-6-8-16-9-7-12;/h3-5,10,12,14,16H,6-9H2,1-2H3;1H |
| InChIKey | CSSCKCIOXGFCNC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |