C14H18ClNO4 — CID 154846082
4-chloro-3-hydroxy-N-[2-methoxy-1-(oxolan-2-yl)ethyl]benzamide (PubChem CID 154846082) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is 4-chloro-3-hydroxy-N-[2-methoxy-1-(oxolan-2-yl)ethyl]benzamide.
| Compound Name | 4-chloro-3-hydroxy-N-[2-methoxy-1-(oxolan-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 154846082 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-chloro-3-hydroxy-N-[2-methoxy-1-(oxolan-2-yl)ethyl]benzamide |
| SMILES | COCC(NC(=O)c1ccc(Cl)c(O)c1)C1CCCO1 |
| InChI | InChI=1S/C14H18ClNO4/c1-19-8-11(13-3-2-6-20-13)16-14(18)9-4-5-10(15)12(17)7-9/h4-5,7,11,13,17H,2-3,6,8H2,1H3,(H,16,18) |
| InChIKey | PLZRHMPORRVTOH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |