C15H18ClNO5 — CID 154846415
3-chloro-4-[4-(1,2-dihydroxyethyl)piperidine-1-carbonyl]benzoic acid (PubChem CID 154846415) has the molecular formula C15H18ClNO5 and a molecular weight of 327.76 g/mol. Its IUPAC name is 3-chloro-4-[4-(1,2-dihydroxyethyl)piperidine-1-carbonyl]benzoic acid.
| Compound Name | 3-chloro-4-[4-(1,2-dihydroxyethyl)piperidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 154846415 |
| Molecular Formula | C15H18ClNO5 |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3-chloro-4-[4-(1,2-dihydroxyethyl)piperidine-1-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCC(C(O)CO)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H18ClNO5/c16-12-7-10(15(21)22)1-2-11(12)14(20)17-5-3-9(4-6-17)13(19)8-18/h1-2,7,9,13,18-19H,3-6,8H2,(H,21,22) |
| InChIKey | BKTMEBGBLDIKHZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |