C28H29N3O3 — CID 154849349
4-methyl-N-[3-[2-(2-methylphenyl)-3-oxopiperazin-1-yl]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 154849349) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-methyl-N-[3-[2-(2-methylphenyl)-3-oxopiperazin-1-yl]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | 4-methyl-N-[3-[2-(2-methylphenyl)-3-oxopiperazin-1-yl]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 154849349 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 4-methyl-N-[3-[2-(2-methylphenyl)-3-oxopiperazin-1-yl]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(CC(=O)N2CCNC(=O)C2c2ccccc2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N3O3/c1-19-12-14-22(15-13-19)27(33)30-24(21-9-4-3-5-10-21)18-25(32)31-17-16-29-28(34)26(31)23-11-7-6-8-20(23)2/h3-15,24,26H,16-18H2,1-2H3,(H,29,34)(H,30,33) |
| InChIKey | RMNGWKKMFLYQLX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |