C19H17BrN2O3 — CID 75396699
1-[2-(2-bromophenyl)-3-oxopiperazin-1-yl]-2-(4-methylphenyl)ethane-1,2-dione (PubChem CID 75396699) has the molecular formula C19H17BrN2O3 and a molecular weight of 401.26 g/mol. Its IUPAC name is 1-[2-(2-bromophenyl)-3-oxopiperazin-1-yl]-2-(4-methylphenyl)ethane-1,2-dione.
| Compound Name | 1-[2-(2-bromophenyl)-3-oxopiperazin-1-yl]-2-(4-methylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 75396699 |
| Molecular Formula | C19H17BrN2O3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 1-[2-(2-bromophenyl)-3-oxopiperazin-1-yl]-2-(4-methylphenyl)ethane-1,2-dione |
| SMILES | Cc1ccc(C(=O)C(=O)N2CCNC(=O)C2c2ccccc2Br)cc1 |
| InChI | InChI=1S/C19H17BrN2O3/c1-12-6-8-13(9-7-12)17(23)19(25)22-11-10-21-18(24)16(22)14-4-2-3-5-15(14)20/h2-9,16H,10-11H2,1H3,(H,21,24) |
| InChIKey | WGGBYJOKCRXKQK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|