C23H26N4O3 — CID 154850327
N-[3-(2,6-dioxopiperidin-1-yl)phenyl]-4-(pyridin-2-ylamino)cyclohexane-1-carboxamide (PubChem CID 154850327) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[3-(2,6-dioxopiperidin-1-yl)phenyl]-4-(pyridin-2-ylamino)cyclohexane-1-carboxamide.
| Compound Name | N-[3-(2,6-dioxopiperidin-1-yl)phenyl]-4-(pyridin-2-ylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 154850327 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[3-(2,6-dioxopiperidin-1-yl)phenyl]-4-(pyridin-2-ylamino)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cccc(N2C(=O)CCCC2=O)c1)C1CCC(Nc2ccccn2)CC1 |
| InChI | InChI=1S/C23H26N4O3/c28-21-8-4-9-22(29)27(21)19-6-3-5-18(15-19)26-23(30)16-10-12-17(13-11-16)25-20-7-1-2-14-24-20/h1-3,5-7,14-17H,4,8-13H2,(H,24,25)(H,26,30) |
| InChIKey | BKSHSJOESGHOLZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|