C20H20ClN5O2 — CID 154850968
2-[4-(6-chloropyrazin-2-yl)oxypiperidin-1-yl]-4-methyl-6-phenoxypyrimidine (PubChem CID 154850968) has the molecular formula C20H20ClN5O2 and a molecular weight of 397.87 g/mol. Its IUPAC name is 2-[4-(6-chloropyrazin-2-yl)oxypiperidin-1-yl]-4-methyl-6-phenoxypyrimidine.
| Compound Name | 2-[4-(6-chloropyrazin-2-yl)oxypiperidin-1-yl]-4-methyl-6-phenoxypyrimidine |
|---|---|
| PubChem CID | 154850968 |
| Molecular Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[4-(6-chloropyrazin-2-yl)oxypiperidin-1-yl]-4-methyl-6-phenoxypyrimidine |
| SMILES | Cc1cc(Oc2ccccc2)nc(N2CCC(Oc3cncc(Cl)n3)CC2)n1 |
| InChI | InChI=1S/C20H20ClN5O2/c1-14-11-18(27-15-5-3-2-4-6-15)25-20(23-14)26-9-7-16(8-10-26)28-19-13-22-12-17(21)24-19/h2-6,11-13,16H,7-10H2,1H3 |
| InChIKey | RDGBMFSXGUFGSQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |