C18H21N3O3 — CID 71563644
4-[6-methyl-2-(4-methylpiperidin-1-yl)pyrimidin-4-yl]oxybenzoic acid (PubChem CID 71563644) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[6-methyl-2-(4-methylpiperidin-1-yl)pyrimidin-4-yl]oxybenzoic acid.
| Compound Name | 4-[6-methyl-2-(4-methylpiperidin-1-yl)pyrimidin-4-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 71563644 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-[6-methyl-2-(4-methylpiperidin-1-yl)pyrimidin-4-yl]oxybenzoic acid |
| SMILES | Cc1cc(Oc2ccc(C(=O)O)cc2)nc(N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-7-9-21(10-8-12)18-19-13(2)11-16(20-18)24-15-5-3-14(4-6-15)17(22)23/h3-6,11-12H,7-10H2,1-2H3,(H,22,23) |
| InChIKey | RSGZMUFTIGEMEZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |