C16H26Cl2N4O2 — CID 154851772
2-[5-oxo-5-(2-phenylmorpholin-4-yl)pentyl]guanidine;dihydrochloride (PubChem CID 154851772) has the molecular formula C16H26Cl2N4O2 and a molecular weight of 377.32 g/mol. Its IUPAC name is 2-[5-oxo-5-(2-phenylmorpholin-4-yl)pentyl]guanidine;dihydrochloride.
| Compound Name | 2-[5-oxo-5-(2-phenylmorpholin-4-yl)pentyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 154851772 |
| Molecular Formula | C16H26Cl2N4O2 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[5-oxo-5-(2-phenylmorpholin-4-yl)pentyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NCCCCC(=O)N1CCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C16H24N4O2.2ClH/c17-16(18)19-9-5-4-8-15(21)20-10-11-22-14(12-20)13-6-2-1-3-7-13;;/h1-3,6-7,14H,4-5,8-12H2,(H4,17,18,19);2*1H |
| InChIKey | PPCVFMJQKXOTJJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|